Select the functional group for carboxylic acids from the following list.

Give the name of the functional group of carboxylic acids.

Which functional group is characteristic of carboxylic acids?a. -OHb. -CHOc. -COOHd. -NH2

Which of the following is classified as a carboxylic acid?Select answer from the options below(CH3)3CCO2CH3(CH3)3CCO2HCO2CH3CO2CH2CH3

Which of the following functional groups is NOT found on the protonated G-acid?A)     AlcoholB)     BenzeneC)     SulfonateD)     Sulfite

Which functional group consists of a hydrocarbon with an -OH group?Group of answer choicesAlcoholsCarboxylic AcidsEstersKetones