Knowee
Questions
Features
Study Tools

The chemical structure of ethanol CH3CH2OH is shown below. Highlight each atom that is in a hydroxy group.

Question

The chemical structure of ethanol CH3CH2OH is shown below. Highlight each atom that is in a hydroxy group.

🧐 Not the exact question you are looking for?Go ask a question

Solution

I'm sorry, but as a text-based AI, I'm unable to highlight images or show chemical structures. However, I can tell you that in the chemical structure of ethanol (CH3CH2OH), the hydroxy group is represented by OH. This group consists of one oxygen atom (O) and one hydrogen atom (H).

Similar Questions

Match the alcohol structure to its classification as either primary, secondary or tertiary.CH3CH(OH)CH2CH3

Which condensed structure(s) contain an ether functional group?CH3CH2CO2CH2CH3CH3CH2OCH2CH3CH3CH(OH)CH2CHOCH3O(CH2)3CHOA.I onlyB.II onlyC.II and IV onlyD.III and IV only

What is the functional group of an alcohol?‒C=C‒OH‒COOH‒COO2Which of the following is the structural formula for butanol?CnH(2n + 2)OC4H9OHC4H10OCH3CH2CH2CH2OH3Which of the following is not a use for alcohols?Cleaning productsFuelsMouthwashCooking oil4Which of the following is a word equation for fermentation?Ethanol + oxidising agent → ethanoic acid + waterGlucose (+ yeast) → ethanol + carbon dioxideEthanol + oxygen → carbon dioxide + waterEthanol + sodium → sodium ethoxide + hydrogen5

Write the name and structure of an alcohol with three carbon atoms in its molecule.’

What kind of molecule is represented by the structure below? CH3CH2CH2CH2CH=CHCH2CH2CH2CH2CH2CH2CH2CH2COOH*1 pointunsaturated fatty acidsdehydrationPhospholipidssaturated fatty acidsmonosaccharide

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.