structural formula of the ester ethyl methanoate
Question
structural formula of the ester ethyl methanoate
Solution
The structural formula for the ester ethyl methanoate (also known as methyl formate) is as follows:
Step 1: Identify the components of the ester. In this case, we have "ethyl" and "methanoate".
Step 2: "Ethyl" refers to a two-carbon chain (-CH2CH3).
Step 3: "Methanoate" refers to a one-carbon carboxylic acid derivative (HCOO-).
Step 4: In an ester, the carboxylic acid derivative is attached to the carbon chain via an oxygen atom.
So, putting it all together, the structural formula for ethyl methanoate is:
HCOOCH2CH3
Similar Questions
Structural formula of ethyne is
Deduce the structural formula of another alcohol which is also an isomer of these alcohols
semi-structural formula for 4-aminopentan-1-ol
Draw the structure of ethyl acetate and ethyl hexanoate
The structure of 4-Methylpent-2-en-1-ol is: (a) CH3CH2CH=CHCH2OH(b)(CH3)2C=CHCH2CH2OH (c)(CH3)2CHCH=CHCH2OH(d)CH3CH(OH)CH-CH=C(CH3)2.
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.