Knowee
Questions
Features
Study Tools

Give the IUPAC name of each salt of a carboxylic acid.Part 1 of 2CH3CH2CH2CH2CO−2Na+

Question

Give the IUPAC name of each salt of a carboxylic acid.Part 1 of 2CH3CH2CH2CH2CO−2Na+

🧐 Not the exact question you are looking for?Go ask a question

Solution

The IUPAC name of the given salt of a carboxylic acid, CH3CH2CH2CH2CO−2Na+, is Sodium pentanoate.

Here's the step-by-step process:

  1. Identify the carboxylic acid: The carboxylic acid here is pentanoic acid (CH3CH2CH2CH2COOH).

  2. Identify the metal ion: The metal ion here is Sodium (Na+).

  3. Combine the names: In IUPAC nomenclature, the salt of a carboxylic acid is named by changing the -oic acid ending of the carboxylic acid to -oate and preceding it with the name of the metal. Therefore, the salt of pentanoic acid with sodium is named Sodium pentanoate.

This problem has been solved

Similar Questions

1. Write IUPAC name of the compound CH3 CH2CH(CH3)CH2CHO.

Which of the following is classified as a carboxylic acid?Select answer from the options below(CH3)3CCO2CH3(CH3)3CCO2HCO2CH3CO2CH2CH3

The IUPAC name for the compound (CH3)2CHCH2CH(NH2)CH3

Identify the missing reactant for the following reaction.Carboxylic acid + _________ → salt + water

Give the IUPAC name of the following structure:CHClCHCH3CH2CH3CH2CH2CHCHCH3

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.