Knowee
Questions
Features
Study Tools

Increasing the number of double bonds in the fatty acid chain, _______________.Group of answer choicesNo answer text provided.decreases the melting point of the triacylglycerol.does not affect the melting point of the triacylglycerol.increases the melting point of the triacylglycerol.

Question

Increasing the number of double bonds in the fatty acid chain, _______________.Group of answer choicesNo answer text provided.decreases the melting point of the triacylglycerol.does not affect the melting point of the triacylglycerol.increases the melting point of the triacylglycerol.

🧐 Not the exact question you are looking for?Go ask a question

Solution

Increasing the number of double bonds in the fatty acid chain decreases the melting point of the triacylglycerol.

Here's why:

  1. Fatty acids are long chains of carbon atoms, with a carboxyl group at one end. Some of these carbon atoms can be connected by double bonds, creating what's known as unsaturated fatty acids.

  2. When there are more double bonds in the fatty acid chain, the fatty acid becomes more unsaturated.

  3. Unsaturated fatty acids have a lower melting point than saturated fatty acids. This is because the double bonds introduce kinks into the fatty acid chain, preventing the chains from packing together tightly.

  4. Triacylglycerols, which are made up of three fatty acids attached to a glycerol molecule, will therefore also have a lower melting point when they contain more unsaturated fatty acids.

So, the more double bonds in the fatty acid chains of a triacylglycerol, the lower its melting point will be.

This problem has been solved

Similar Questions

Which fatty acid would have the lowest melting point?Question 8Answera.Linolenic acidb.Myristic acidc.Palmitic acidd.Linoleic acidClear my choice

Which fatty acid has the lowest melting point?Multiple ChoiceCH3(CH2)5CH=CH(CH2)7COOHCH3(CH2)16COOHCH3(CH2)4CH=CHCH2CH=CH(CH2)7COOHCH3(CH2)24COOHCH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH

The ester bond in the triacylglycerol can be hydrolyzed in the presence of _____________.

Triglycerides are formed when three fatty acids bond with what kind of molecule?SteroidGlycerolOxygenWater

A triglyceride molecule, also called a fat molecule, consists of a glycerol bonded to three long carbon chains called ______ acids.Multiple choice question.fattypyruvicaminonucleic

1/2

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.