Knowee
Questions
Features
Study Tools

State the number of expected 1H NMR signals AND their integral ratio for the following structure: CH3CH2COCH2CH3Group of answer choices4 signals is a 3:2:2:3 ratio2 signals is a 6:4 ratio2 signals is a 3:2 ratio

Question

State the number of expected 1H NMR signals AND their integral ratio for the following structure: CH3CH2COCH2CH3Group of answer choices4 signals is a 3:2:2:3 ratio2 signals is a 6:4 ratio2 signals is a 3:2 ratio

🧐 Not the exact question you are looking for?Go ask a question

Solution

The molecule CH3CH2COCH2CH3 is pentanone.

In this molecule, there are four different types of hydrogen environments:

  1. The three hydrogen atoms attached to the carbon atom in the -CH3 group at the end of the molecule.

  2. The two hydrogen atoms attached to the carbon atom in the -CH2- group that is directly attached to the carbonyl group (C=O).

  3. The two hydrogen atoms attached to the carbon atom in the -CH2- group that is directly attached to the -CH3 group.

  4. The three hydrogen atoms attached to the carbon atom in the -CH3 group at the other end of the molecule.

The integral ratio corresponds to the number of protons in each environment. So, the integral ratio would be 3:2:2:3.

So, the correct answer is: 4 signals in a 3:2:2:3 ratio.

This problem has been solved

Similar Questions

Which of the following molecules will produce a 1H-NMR spectrum with a peak area ratio of 3 : 1?I   CH3CH2CH3 II  CH3CHCl2III CH3OH

How many signals are expected in the 1H NMR spectrum of pentane?Select answer from the options below12345Save for LaterSubmit Answer

Which of the following compounds exhibits three signals in its 13C NMR spectrum?Select answer from the options below(CH3)2CHCH(CH3)2BrCH2CH2CH2Cl(CH3)2CHOCH(CH3)2BrCH2CH2CH2Br

Which of the following is true about the area under each signal in a 1H NMR spectrum?Select answer from the options belowIt indicates the number of protons giving rise to the signal.It indicates the number of neighboring protons.  It indicates the electronic environment of neighboring protons.  It indicates the number of different protons.

Which of the following is true about the number of signals in a 1H NMR spectrum?Select answer from the options belowIt indicates the electronic environment of absorbing protons.  It indicates the number of different kinds of protons.  It indicates the number of neighboring protons.  It indicates the electronic environment of neighboring protons.

1/2

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.