What is the formula for the ether functional group?A.OHB.OC.COOD.COOH
Question
What is the formula for the ether functional group?A.OHB.OC.COOD.COOH
Solution
The formula for the ether functional group is B. O. In organic chemistry, an ether is any group of organic compounds in which an oxygen atom is bonded to two alkyl or aryl groups. The general formula for an ether is R–O–R', where R and R' represent any alkyl or aryl group.
Similar Questions
What is the name for the -COOH function group?
Which condensed structure(s) contain an ether functional group?CH3CH2CO2CH2CH3CH3CH2OCH2CH3CH3CH(OH)CH2CHOCH3O(CH2)3CHOA.I onlyB.II onlyC.II and IV onlyD.III and IV only
Which of the following functional groups is matched with its correct name?ANSWERR-NH2: methyl groupR-OH: hydroxyl groupR-CH3: ester groupR-COOH: ether group
What is the functional group of an alcohol?‒C=C‒OH‒COOH‒COO2Which of the following is the structural formula for butanol?CnH(2n + 2)OC4H9OHC4H10OCH3CH2CH2CH2OH3Which of the following is not a use for alcohols?Cleaning productsFuelsMouthwashCooking oil4Which of the following is a word equation for fermentation?Ethanol + oxidising agent → ethanoic acid + waterGlucose (+ yeast) → ethanol + carbon dioxideEthanol + oxygen → carbon dioxide + waterEthanol + sodium → sodium ethoxide + hydrogen5
Which functional group has the general formula NH2?A.AmineB.ThiolC.EsterD.Alcohol
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.