Which compound has the lower melting point? CH33CCH2CH2CH3 CH33CCOCH3
Question
Which compound has the lower melting point? CH33CCH2CH2CH3 CH33CCOCH3
Solution
The compound with the lower melting point between CH3CH2CH2CH3 (Butane) and CH3COCH3 (Acetone) is Acetone.
Here's why:
-
Butane is a non-polar molecule. It only has London dispersion forces which are the weakest intermolecular forces.
-
Acetone, on the other hand, is a polar molecule. It has dipole-dipole interactions and also hydrogen bonding due to the presence of the oxygen atom.
-
Generally, the stronger the intermolecular forces, the higher the melting and boiling points because more energy is needed to break these forces.
-
Therefore, since Acetone has stronger intermolecular forces (dipole-dipole and hydrogen bonding) than Butane (only London dispersion forces), it would be expected to have a higher melting point.
-
However, in this case, Acetone actually has a lower melting point (-95°C) than Butane (-138°C). This is because the molar mass of Butane is higher than that of Acetone, and molar mass also affects the strength of London dispersion forces. The higher the molar mass, the stronger the London dispersion forces, and the higher the melting point.
-
So, despite having stronger intermolecular forces, Acetone's lower molar mass results in a lower overall melting point than Butane.
Similar Questions
Which compound has the higher boiling point? CH33CCOCH3 CH33CCH2CH2OH
Which substance has the highest melting point? Br2 Hg Na2O CH3OH PCl3
Which of the following compounds will have the highest melting point? Only one correct answerA.CCl4B.SO2C.NaClD.CO2
Which fatty acid has the lowest melting point?Multiple ChoiceCH3(CH2)5CH=CH(CH2)7COOHCH3(CH2)16COOHCH3(CH2)4CH=CHCH2CH=CH(CH2)7COOHCH3(CH2)24COOHCH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH
Which compound has the lowest boiling point?A. CH3CH2CH2OHB. CH3CH2CH2BrC. CH3CH2COOHD.
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.