What is the correct name for N2O4?A.Nitrogen oxideB.Nitrogen tetroxideC.Dinitrogen trioxideD.Dinitrogen tetroxideSUBMITarrow_backPREVIOUS
Question
What is the correct name for N2O4?A.Nitrogen oxideB.Nitrogen tetroxideC.Dinitrogen trioxideD.Dinitrogen tetroxideSUBMITarrow_backPREVIOUS
Solution
The correct name for N2O4 is Dinitrogen tetroxide. So, the correct answer is D. Dinitrogen tetroxide.
Similar Questions
Choose the correct name for N2O3.
The name for NH4NO3 isammonium nitrate.ammonium nitrogen trioxide.ammonia nitrogen oxide.hydrogen nitrogen oxide.hydrogen nitrate.
Provide the correct IUPAC name for the following compound[Ni(NH3)4(H2O)2]SO4
Nitrogen is obtained by the thermal decomposition of:NH4NO2NH4NO3AgNO3Pb(NO3)2
What is the chemical formula for the compound containing one nitrogen atom and two oxygen atoms?ANOBNO2CO2NDN2O
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.