Knowee
Questions
Features
Study Tools

What is the correct name for N2O4?A.Nitrogen oxideB.Nitrogen tetroxideC.Dinitrogen trioxideD.Dinitrogen tetroxideSUBMITarrow_backPREVIOUS

Question

What is the correct name for N2O4?A.Nitrogen oxideB.Nitrogen tetroxideC.Dinitrogen trioxideD.Dinitrogen tetroxideSUBMITarrow_backPREVIOUS

🧐 Not the exact question you are looking for?Go ask a question

Solution

The correct name for N2O4 is Dinitrogen tetroxide. So, the correct answer is D. Dinitrogen tetroxide.

Similar Questions

Choose the correct name for N2O3.

The name for NH4NO3 isammonium nitrate.ammonium nitrogen trioxide.ammonia nitrogen oxide.hydrogen nitrogen oxide.hydrogen nitrate.

Provide the correct IUPAC name for the following compound[Ni(NH3)4(H2O)2]SO4

Nitrogen is obtained by the thermal decomposition of:NH4NO2NH4NO3AgNO3Pb(NO3)2

What is the chemical formula for the compound containing one nitrogen atom and two oxygen atoms?ANOBNO2CO2NDN2O

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.