Which compound has the lower melting point? CH33CCH2OH CH33CCHO
Question
Which compound has the lower melting point? CH33CCH2OH CH33CCHO
Solution
The compounds mentioned in the question seem to be incorrectly written. However, if we assume that the compounds are CH3CH2OH (ethanol) and CH3CHO (acetaldehyde), we can compare their melting points.
-
Identify the type of intermolecular forces in each compound:
Ethanol (CH3CH2OH) has hydrogen bonding due to the presence of an -OH group. Acetaldehyde (CH3CHO) has dipole-dipole interactions due to the presence of a polar C=O bond.
-
Compare the strength of the intermolecular forces:
Hydrogen bonding is a stronger intermolecular force than dipole-dipole interactions.
-
Relate the strength of the intermolecular forces to the melting point:
The stronger the intermolecular forces, the higher the melting point. Therefore, ethanol (CH3CH2OH) with hydrogen bonding should have a higher melting point than acetaldehyde (CH3CHO) with dipole-dipole interactions.
So, acetaldehyde (CH3CHO) should have a lower melting point than ethanol (CH3CH2OH).
Similar Questions
Which compound has the higher boiling point? CH33CCOCH3 CH33CCH2CH2OH
Which substance has the highest melting point? Br2 Hg Na2O CH3OH PCl3
Which of the following compounds will have the highest melting point? Only one correct answerA.CCl4B.SO2C.NaClD.CO2
Which fatty acid has the lowest melting point?Multiple ChoiceCH3(CH2)5CH=CH(CH2)7COOHCH3(CH2)16COOHCH3(CH2)4CH=CHCH2CH=CH(CH2)7COOHCH3(CH2)24COOHCH3CH2CH=CHCH2CH=CHCH2CH=CH(CH2)7COOH
Which compound has the lowest boiling point?A. CH3CH2CH2OHB. CH3CH2CH2BrC. CH3CH2COOHD.
Upgrade your grade with Knowee
Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.