4-phenylbutan-2-ol What functional groups other than alkane/cycloalkane are present in the above molecule? (e.g. haloalkane, alkyne, aromatic) Type the name of the functional group(s) in the given blanks, one group per blank. This molecule contains the functional groups and . What is the IUPAC basename for this molecule (e.g. phenol, benzene, pentane) The chain will be numbered (clockwise, counterclockwise, either, left to right, right to left) .

What is the functional group of alkane

Which one of the following structures corresponds to 4-phenoxyheptane?Select answer from the options belowCH3CH2CH2CH(OCH2Ph)CH2CH2CH3CH3CH2CH2CH(OPh)CH2CH2CH3CH3CH2CH(OCH2Ph)CH2CH2CH3CH3CH2CH(OPh)CH2CH2CH3CH3(CH2)3CH(OPh)CH2CH3

Name the following compound: (It has a benzene ring and one Carboxylic acid functional group)Group of answer choicesBenzene carboxylicBenzeneBenzoic acidPhenol

Which of the following is the resulting functional group on ozonolysis of an internal alkyne?Select answer from the options belowcarboxylic acidesterketonealdehyde

Which functional group consists of a hydrocarbon with an -OH group?Group of answer choicesAlcoholsCarboxylic AcidsEstersKetones