If a precipitation reaction occurs, what will be the products of the unbalanced reaction shown below?AgNO3(aq) + NaCl(aq) Solubility TableA.AgCl(s) + NaNO3(aq)B.AgCl(aq) + NaNO3(s)C.AgCl(s) + NaNO3(s)D.No precipitate will form.

Identify the precipitate in this reaction:AgNO3 (aq) + NaCl (aq) → AgCl (s) + NaNO3 (aq)

If a reaction occurs, what will be the products of the unbalanced reaction below?Zn(s) + HCl(aq) The Activity Series of ElementsA.ZnH(s) + Cl2(g)B.HZnCl(s)C.ZnCl2(s) + H2(g)D.No reaction will occur.

Identify the type of reaction below:NaCl (aq) + AgNO3 (aq) --> AgCl(s) + NaNO3 (aq)Group of answer choicesdecomposition reactionsingle replacement reactionprecipitation reactioncombination reaction

Consider the following reaction:AgNO3 (aq) + NaOH (aq) → NaNO3 (aq) + AgOH (s)silver nitrate + sodium hydroxide → sodium nitrate + silver hydroxideIdentify the precipitate and explain why it forms. 

Which of the following is an example of precipitation reaction?Group of answer choicesDissolving sugar in waterBoiling silver chloride in waterMixing silver nitrate and sodium chloride solutionsBurning wood in air