Knowee
Questions
Features
Study Tools

Simple aliphatic carboxylic acids upto four carbon atoms are miscible in water due to the formation of hydrogen bond with water.Statement-II : The simplest aromatic carboxylic acid is nearly insoluble in cold water.A Statement-I and II both are correct. B Statement-I is incorrect but statement-II is correct. C Statement-I is correct but statement-II is false. D Both statement-I and II are incorrect.

Question

Simple aliphatic carboxylic acids upto four carbon atoms are miscible in water due to the formation of hydrogen bond with water.Statement-II : The simplest aromatic carboxylic acid is nearly insoluble in cold water.A Statement-I and II both are correct. B Statement-I is incorrect but statement-II is correct. C Statement-I is correct but statement-II is false. D Both statement-I and II are incorrect.

...expand
🧐 Not the exact question you are looking for?Go ask a question

Solution

Statement-I: Simple aliphatic carboxylic acids up to four carbon atoms are miscible in water due to the formation of hydrogen bonds with water.

Explanation:

  1. Simple aliphatic carboxylic acids refer to carboxylic acids that have a straight chain of carbon atoms and no other functional groups.
  2. These carboxylic acids have a polar functional group called the carboxyl group (-COOH), which can form hydrogen bonds with water molecules.
  3. The formation of hydrogen bonds between the carboxylic acid and water molecules allows for the molecules to mix and dissolve in water.
  4. Therefore, statement-I is correct.

Statement-II: The simplest aromatic carboxylic acid is nearly insoluble in cold water.

Explanation:

  1. Aromatic carboxylic acids are carboxylic acids that have an aromatic ring attached to the carboxyl group.
  2. The simplest aromatic carboxylic acid is benzoic acid (C6H5COOH).
  3. Due to the presence of the aromatic ring, benzoic acid is less polar compared to aliphatic carboxylic acids.
  4. The lower polarity of benzoic acid makes it less likely to form hydrogen bonds with water molecules.
  5. As a result, benzoic acid is nearly insoluble in cold water.
  6. Therefore, statement-II is correct.

Based on the explanations provided, the correct answer is option B: Statement-I is incorrect, but statement-II is correct.

This problem has been solved

Similar Questions

Higher carboxylic acid are wax like solid and are practically odourless.Statement-II : Carboxylic acids are higher boiling point liquids than aldehyde, ketone, this is due to extensive association of carboxylic acid molecules through intra-molecular hydrogen bonding.A Statement-I and II both  are correct B Statement-I is incorrect but statement-II is correct C Statement-I is correct but statement-II is false D Both statement-I and II are incorrect

Lower aliphatic amines are soluble in water because they can form hydrogen bonds with water.Statement-II : Higher aliphatic amines are essentially insoluble in water, due to increase in size of hydrophilic alkyl group.A Statement-I and II both are correct. B Statement-I is incorrect but statement-II is correct. C Statement-I is correct but statement-II is false. D Both statement-I and II are incorrect.

Lower member of aldehydes and ketones are soluble in water due to dipole-dipole interaction.Statement-II : All aldehyde and ketones are fairly soluble in organic solvents like benzene, ether, methanol and chloroform etc.A Statement-I and II both are correct. B Statement-I is incorrect but statement-II is correct. C Statement-I is correct but statement-II is false. D Both statement-I and II are incorrect.

Direct attachment of groups such as phenyl or vinyl to the carboxylic acid, increases the acidity of corresponding carboxylic acid.Statement-II : Greater electronegativity of sp2 hybridised carbon, attached with carboxyl group enhance its acidic strength.A Statement-I and II both are correct and statement-II is correct explanation of statement-I B Statement-I and II both are correct but statement-II is not correct explanation of statement-I C Statement-I is correct but statement-II is false. D Both Statement-I and II are incorrect.

Which of the following is classified as a carboxylic acid?Select answer from the options below(CH3)3CCO2CH3(CH3)3CCO2HCO2CH3CO2CH2CH3

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.