Knowee
Questions
Features
Study Tools

The correct semi-structural formula for 1,4-dichlorobutan-2-ol is

Question

The correct semi-structural formula for 1,4-dichlorobutan-2-ol is

🧐 Not the exact question you are looking for?Go ask a question

Solution

The semi-structural formula for 1,4-dichlorobutan-2-ol is:

CH2Cl-CH(OH)-CH2-CH2Cl

Here's the step-by-step explanation:

  1. The prefix "butan" in the name indicates that there are four carbon atoms in the longest continuous chain. This forms the base of the molecule.

  2. The "1,4-dichloro" part of the name indicates that there are chlorine atoms attached to the first and fourth carbon atoms in the chain.

  3. The "2-ol" part of the name indicates that there is a hydroxyl (-OH) group attached to the second carbon atom in the chain.

  4. Therefore, starting from the left, the first carbon atom has a chlorine atom attached, the second carbon atom has a hydroxyl group attached, and the fourth carbon atom has a chlorine atom attached. The remaining bonds on the carbon atoms are filled with hydrogen atoms.

  5. The semi-structural formula is written as CH2Cl-CH(OH)-CH2-CH2Cl.

This problem has been solved

Similar Questions

semi-structural formula for 4-aminopentan-1-ol

The structure of 4-Methylpent-2-en-1-ol is: (a) CH3CH2CH=CHCH2OH(b)(CH3)2C=CHCH2CH2OH (c)(CH3)2CHCH=CHCH2OH(d)CH3CH(OH)CH-CH=C(CH3)2.

What is the formula of the following compound? disulfur dichloride

Which one of the following structures corresponds to 4-phenoxyheptane?Select answer from the options belowCH3CH2CH(OCH2Ph)CH2CH2CH3CH3(CH2)3CH(OPh)CH2CH3CH3CH2CH2CH(OCH2Ph)CH2CH2CH3CH3CH2CH2CH(OPh)CH2CH2CH3CH3CH2CH(OPh)CH2CH2CH3

Match the column  Column-ICompounds   Column-IIpKb(I) N-Methylmethanamine (a) 3.25(II) N,N-Diethylethanamine (b) 3.29(III) Ethanamine (c) 3.27(IV) Phenylmethanamine (d) 4.70A I-a, II-c, III-b, IV-d B I-c, II-b, III-a, IV-d C I-c, II-a, III-b, IV-d D I-c, II-a, III-d, IV-b

1/2

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.