Amines have basic properties because of the presence of __________.Group of answer choicesa positive charge on the nitrogen atomthe ability of the nitrogen atom to give up hydrogen atomsa hydroxyl group bonded to N atoman unshared pair of electrons on the nitrogen atom

CH3-CH2-NH-CH3 is a __________Group of answer choicessecondary amineprimary aminequaternary aminetertiary amine

Choose the incorrect statement from the following.In case of primary, secondary and tertiary amines, the basic strength depends on the extent of hydrogen bonding in the protonated amines.The presence of groups like −OCH3 and −CH3 increases the basic strength of amines.The presence of groups like −NO2, CN and halogens reduces the basic strength of amines.The basic strength of amines depends on their concentration.

Which compound is a secondary amine?Group of answer choices(CH3)2NCH2CH3NH2CH2CH3CH3CH2NHCH(CH3)CH2CH3CH3CH(NH2)CH3

Amines function chemically as organic ____.Group of answer choicesacidsbasessaltsmore than one response is correct

Which of the following amines can hydrogen bond with WATER?Group of answer choicesnone of thesejust tertiaryprimary and secondaryall three (primary, secondary, and tertiary)