Which of the following amines can hydrogen bond with WATER?Group of answer choicesnone of thesejust tertiaryprimary and secondaryall three (primary, secondary, and tertiary)

Which compound is a secondary amine?Group of answer choices(CH3)2NCH2CH3NH2CH2CH3CH3CH2NHCH(CH3)CH2CH3CH3CH(NH2)CH3

Which of the following molecules can form hydrogen bonds in its molecules ?         I. CH3I       II. CH3NH2       III. CH3OH

Which of the following can hydrogen bond? (Choose all that apply) *1 pointCH3-O-CH3CHCl3H2ODNA

Intermolecular association decrease from primary to tertiary amine because no. of hydrogen bond decreases. So order of boiling point in isomeric amines.Primary  > Secondary > TertiaryStatement-II : Boiling point of alcohols are greater than amines when they have comparable molecular mass due to greater H-bond strength in alcohol.A Statement-I and II both  are correct B Statement-I is incorrect but statement-II is correct. C Statement-I is correct but statement-II is false. D Both statement-I and II are incorrect.

How many of the following liquids have hydrogen bonds present:ammonia, methanol, acetic acid and hydrofluoric acidQuestion 3Select one:a.all of themb.only methanolc.methanol, ammonia and hydrofluoric acidd.only methanol and acetic acide.only hydrofluoric acid