Knowee
Questions
Features
Study Tools

To find the resultant vector using the numerical method, we need to break each vector into its components and then sum the components. ### Step 1: Break each vector into its components#### Vector \(\vec{A}\) Magnitude: \(A = 60\) Angle: \(\theta_1 = 45^\circ\) Components: \[ A_x = A \cos(\theta_1) = 60 \cos(45^\circ) = 60 \left(\frac{\sqrt{2}}{2}\right) = 60 \times 0.7071 = 42.43 \] \[ A_y = A \sin(\theta_1) = 60 \sin(45^\circ) = 60 \left(\frac{\sqrt{2}}{2}\right) = 60 \times 0.7071 = 42.43 \] #### Vector \(\vec{B}\) Magnitude: \(B = 60\) Angle: \(\theta_2 = 20^\circ\) (below the horizontal axis, so it's negative) Components: \[ B_x = B \cos(\theta_2) = 60 \cos(20^\circ) = 60 \times 0.9397 = 56.38 \] \[ B_y = B \sin(\theta_2) = 60 \sin(20^\circ) = 60 \times 0.3420 = 20.52 \] Since \(\theta_2\) is below the horizontal axis, \(B_y\) is negative: \[ B_y = -20.52 \] #### Vector \(\vec{C}\) Magnitude: \(C = 60\) Angle: \(180^\circ\) (directly to the left) Components: \[ C_x = C \cos(180^\circ) = 60 \cos(180^\circ) = 60 \times (-1) = -60 \] \[ C_y = C \sin(180^\circ) = 60 \sin(180^\circ) = 60 \times 0 = 0 \] ### Step 2: Sum the components#### Sum of \(x\)-components: \[ R_x = A_x + B_x + C_x \] \[ R_x = 42.43 + 56.38 - 60 \] \[ R_x = 38.81 \] #### Sum of \(y\)-components: \[ R_y = A_y + B_y + C_y \] \[ R_y = 42.43 - 20.52 + 0 \] \[ R_y = 21.91 \] ### Step 3: Find the magnitude and direction of the resultant vector#### Magnitude: \[ R = \sqrt{R_x^2 + R_y^2} \] \[ R = \sqrt{(38.81)^2 + (21.91)^2} \] \[ R = \sqrt{1506.29 + 479.36} \] \[ R = \sqrt{1985.65} \] \[ R \approx 44.56 \] #### Direction (angle \(\theta\) with respect to the positive x-axis): \[ \theta = \tan^{-1}\left(\frac{R_y}{R_x}\right) \] \[ \theta = \tan^{-1}\left(\frac{21.91}{38.81}\right) \] \[ \theta \approx 29.4^\circ \] ### ResultThe resultant vector has a magnitude of approximately \(44.56\) and makes an angle of approximately \(29.4^\circ\) with the positive x-axis.

Question

To find the resultant vector using the numerical method, we need to break each vector into its components and then sum the components. ### Step 1: Break each vector into its components#### Vector A\vec{A} Magnitude: A=60A = 60 Angle: θ1=45\theta_1 = 45^\circ Components: Ax=Acos(θ1)=60cos(45)=60(22)=60×0.7071=42.43 A_x = A \cos(\theta_1) = 60 \cos(45^\circ) = 60 \left(\frac{\sqrt{2}}{2}\right) = 60 \times 0.7071 = 42.43 Ay=Asin(θ1)=60sin(45)=60(22)=60×0.7071=42.43 A_y = A \sin(\theta_1) = 60 \sin(45^\circ) = 60 \left(\frac{\sqrt{2}}{2}\right) = 60 \times 0.7071 = 42.43 #### Vector B\vec{B} Magnitude: B=60B = 60 Angle: θ2=20\theta_2 = 20^\circ (below the horizontal axis, so it's negative) Components: Bx=Bcos(θ2)=60cos(20)=60×0.9397=56.38 B_x = B \cos(\theta_2) = 60 \cos(20^\circ) = 60 \times 0.9397 = 56.38 By=Bsin(θ2)=60sin(20)=60×0.3420=20.52 B_y = B \sin(\theta_2) = 60 \sin(20^\circ) = 60 \times 0.3420 = 20.52 Since θ2\theta_2 is below the horizontal axis, ByB_y is negative: By=20.52 B_y = -20.52 #### Vector C\vec{C} Magnitude: C=60C = 60 Angle: 180180^\circ (directly to the left) Components: Cx=Ccos(180)=60cos(180)=60×(1)=60 C_x = C \cos(180^\circ) = 60 \cos(180^\circ) = 60 \times (-1) = -60 Cy=Csin(180)=60sin(180)=60×0=0 C_y = C \sin(180^\circ) = 60 \sin(180^\circ) = 60 \times 0 = 0 ### Step 2: Sum the components#### Sum of xx-components: Rx=Ax+Bx+Cx R_x = A_x + B_x + C_x Rx=42.43+56.3860 R_x = 42.43 + 56.38 - 60 Rx=38.81 R_x = 38.81 #### Sum of yy-components: Ry=Ay+By+Cy R_y = A_y + B_y + C_y Ry=42.4320.52+0 R_y = 42.43 - 20.52 + 0 Ry=21.91 R_y = 21.91 ### Step 3: Find the magnitude and direction of the resultant vector#### Magnitude: R=Rx2+Ry2 R = \sqrt{R_x^2 + R_y^2} R=(38.81)2+(21.91)2 R = \sqrt{(38.81)^2 + (21.91)^2} R=1506.29+479.36 R = \sqrt{1506.29 + 479.36} R=1985.65 R = \sqrt{1985.65} R44.56 R \approx 44.56 #### Direction (angle θ\theta with respect to the positive x-axis): θ=tan1(RyRx) \theta = \tan^{-1}\left(\frac{R_y}{R_x}\right) θ=tan1(21.9138.81) \theta = \tan^{-1}\left(\frac{21.91}{38.81}\right) θ29.4 \theta \approx 29.4^\circ ### ResultThe resultant vector has a magnitude of approximately 44.5644.56 and makes an angle of approximately 29.429.4^\circ with the positive x-axis.

...expand
🧐 Not the exact question you are looking for?Go ask a question

Solution

The process to find the resultant vector using the numerical method involves breaking each vector into its components and then summing the components.

Step 1: Break each vector into its components Vector A has a magnitude of 60 and an angle of 45 degrees. Its components are 42.43 in the x direction and 42.43 in the y direction.

Vector B has a magnitude of 60 and an angle of 20 degrees (below the horizontal axis, so it's negative). Its components are 56.38 in the x direction and -20.52 in the y direction.

Vector C has a magnitude of 60 and an angle of 180 degrees (directly to the left). Its components are -60 in the x direction and 0 in the y direction.

Step 2: Sum the components The sum of the x-components is 38.81 and the sum of the y-components is 21.91.

Step 3: Find the magnitude and direction of the resultant vector The magnitude of the resultant vector is approximately 44.56. The direction (angle with respect to the positive x-axis) is approximately 29.4 degrees.

So, the resultant vector has a magnitude of approximately 44.56 and makes an angle of approximately 29.4 degrees with the positive x-axis.

This problem has been solved

Similar Questions

To find the resultant vector using the numerical method, we need to break each vector into its components and then sum the components. ### Step 1: Break each vector into its components#### Vector \(\vec{A}\) Magnitude: \(A = 60\) Angle: \(\theta_1 = 45^\circ\) Components: \[ A_x = A \cos(\theta_1) = 60 \cos(45^\circ) = 60 \left(\frac{\sqrt{2}}{2}\right) = 60 \times 0.7071 = 42.43 \] \[ A_y = A \sin(\theta_1) = 60 \sin(45^\circ) = 60 \left(\frac{\sqrt{2}}{2}\right) = 60 \times 0.7071 = 42.43 \] #### Vector \(\vec{B}\) Magnitude: \(B = 60\) Angle: \(\theta_2 = 20^\circ\) (below the horizontal axis, so it's negative) Components: \[ B_x = B \cos(\theta_2) = 60 \cos(20^\circ) = 60 \times 0.9397 = 56.38 \] \[ B_y = B \sin(\theta_2) = 60 \sin(20^\circ) = 60 \times 0.3420 = 20.52 \] Since \(\theta_2\) is below the horizontal axis, \(B_y\) is negative: \[ B_y = -20.52 \] #### Vector \(\vec{C}\) Magnitude: \(C = 60\) Angle: \(180^\circ\) (directly to the left) Components: \[ C_x = C \cos(180^\circ) = 60 \cos(180^\circ) = 60 \times (-1) = -60 \] \[ C_y = C \sin(180^\circ) = 60 \sin(180^\circ) = 60 \times 0 = 0 \] ### Step 2: Sum the components#### Sum of \(x\)-components: \[ R_x = A_x + B_x + C_x \] \[ R_x = 42.43 + 56.38 - 60 \] \[ R_x = 38.81 \] #### Sum of \(y\)-components: \[ R_y = A_y + B_y + C_y \] \[ R_y = 42.43 - 20.52 + 0 \] \[ R_y = 21.91 \] ### Step 3: Find the magnitude and direction of the resultant vector#### Magnitude: \[ R = \sqrt{R_x^2 + R_y^2} \] \[ R = \sqrt{(38.81)^2 + (21.91)^2} \] \[ R = \sqrt{1506.29 + 479.36} \] \[ R = \sqrt{1985.65} \] \[ R \approx 44.56 \] #### Direction (angle \(\theta\) with respect to the positive x-axis): \[ \theta = \tan^{-1}\left(\frac{R_y}{R_x}\right) \] \[ \theta = \tan^{-1}\left(\frac{21.91}{38.81}\right) \] \[ \theta \approx 29.4^\circ \] ### ResultThe resultant vector has a magnitude of approximately \(44.56\) and makes an angle of approximately \(29.4^\circ\) with the positive x-axis.

When using the graphical method for vector addition, how is the resultant vector represented in the diagram?Group of answer choicesAs the longest vector in the diagramAs the vector closest to the x-axisAs the sum of vector magnitudesAs the diagonal connecting the tail of the first vector to the head of the last vector.

Find the resultant of the following vectors. Round to 1 d.p.30∠70°and10∠340°

Given the vectors M = 5i - 3j and  N  = -3i + 2k, what is the resultant?Group of answer choices-i – j2i - 3j + 2k-i – ki + 3j - 2k

How do you calculate the resultant force from a vector diagram?

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.