Knowee
Questions
Features
Study Tools

___ (NH4)3PO4 + ___ Pb(NO3)4 --> ___ Pb3(PO4)4 +  ___ NH4NO3

Question

___ (NH4)3PO4 + ___ Pb(NO3)4 --> ___ Pb3(PO4)4 +  ___ NH4NO3

🧐 Not the exact question you are looking for?Go ask a question

Solution 1

This is a balanced chemical equation problem. The goal is to find the coefficients that make the number of atoms of each element equal on both sides of the equation. Here's how you can do it:

  1. Write down the unbalanced equation:

    (NH4)3PO4 + Pb(NO3)4 --> Pb3(PO4)4 + NH4NO3

  2. Balance the equation for the lead (Pb) atoms first. There are 3 lead atoms on the product side, so you need 3 lead atoms on the reactant side:

    (NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + NH4NO3

  3. Next, balance the equation for the nitrate (NO3) groups. There are 12 nitrate groups on the reactant side (3 Pb(NO3)4), so you need 12 nitrate groups on the product side:

    (NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + 12NH4NO3

  4. Now, balance the equation for the ammonium (NH4) groups. There are 12 ammonium groups on the product side (12 NH4NO3), so you need 12 ammonium groups on the reactant side:

    4(NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + 12NH4NO3

  5. Finally, balance the equation for the phosphate (PO4) groups. There are 4 phosphate groups on the reactant side (4 (NH4)3PO4), so you need 4 phosphate groups on the product side:

    4(NH4)3PO4 + 3Pb(NO3)4 --> 4Pb3(PO4)4 + 12NH4NO3

So, the balanced chemical equation is:

4(NH4)3PO4 + 3Pb(NO3)4 --> 4Pb3(PO4)4 + 12NH4NO3

This problem has been solved

Solution 2

This is a balanced chemical equation problem. Here's how you solve it:

The unbalanced equation is: (NH4)3PO4 + Pb(NO3)4 --> Pb3(PO4)4 + NH4NO3

To balance it, you need to ensure that the number of atoms for each element on the reactant side (left) is equal to the number of atoms for each element on the product side (right).

Step 1: Balance the lead (Pb) atoms first. There are 3 Pb atoms on the product side, so you need 3 Pb(NO3)4 on the reactant side. Now the equation looks like this: (NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + NH4NO3

Step 2: Balance the phosphate (PO4) groups next. There are 4 PO4 groups on the product side, so you need 4 (NH4)3PO4 on the reactant side. Now the equation looks like this: 4(NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + NH4NO3

Step 3: Balance the ammonium (NH4) groups. There are 12 NH4 groups on the reactant side, so you need 12 NH4NO3 on the product side. Now the equation looks like this: 4(NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + 12NH4NO3

Step 4: Finally, balance the nitrate (NO3) groups. There are 12 NO3 groups on the reactant side, so the 12 NH4NO3 on the product side already balances this out.

So, the balanced chemical equation is: 4(NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + 12NH4NO3

This problem has been solved

Solution 3

This is a balanced chemical equation problem. The goal is to find the coefficients that make the number of atoms of each element equal on both sides of the equation.

Here is the balanced equation:

1 (NH4)3PO4 + 3 Pb(NO3)4 --> 1 Pb3(PO4)4 + 12 NH4NO3

Here's how we got there:

  1. Start with the original equation: (NH4)3PO4 + Pb(NO3)4 --> Pb3(PO4)4 + NH4NO3
  2. Balance the lead (Pb) atoms first. There are 3 Pb atoms on the product side, so put a 3 in front of Pb(NO3)4 on the reactant side: (NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + NH4NO3
  3. Now balance the nitrate (NO3) groups. There are 12 NO3 groups on the reactant side (3 Pb(NO3)4), so put a 12 in front of NH4NO3 on the product side: (NH4)3PO4 + 3Pb(NO3)4 --> Pb3(PO4)4 + 12NH4NO3
  4. Finally, check the ammonium (NH4) groups and phosphate (PO4) groups. There are 3 NH4 groups and 1 PO4 group on the reactant side, and 12 NH4 groups and 1 PO4 group on the product side, so they are already balanced.

So, the balanced equation is: 1 (NH4)3PO4 + 3 Pb(NO3)4 --> 1 Pb3(PO4)4 + 12 NH4NO3

This problem has been solved

Similar Questions

ii)Pb(NO3)2 + ---------- NaCl ---> ------------- + -------------

36. What is the formula of ammonium phosphate?1 point(NH4)3PO4NH4(PO4)3NH4PO4N3H12PO4

When lead nitrate reacts with potassium iodide, yellow precipitate ofPbI2 is formedKNO3 is formedPb(NO3)2 is formedPbIO3 is formed

What is the name of this chemical? NH4+

The hybridisation of ‘P’ in PO4–3 ion is the same as in :-I in ICl4– S in SO3  N in NO3–S in SO3–2

1/3

Upgrade your grade with Knowee

Get personalized homework help. Review tough concepts in more detail, or go deeper into your topic by exploring other relevant questions.